About 3-imidazol-1-ylpyridine;dihydrochloride
3-imidazol-1-ylpyridine;dihydrochloride (PubChem CID 91642740) has the molecular formula C8H9Cl2N3
and a molecular weight of 218.09 g/mol. Its IUPAC name is 3-imidazol-1-ylpyridine;dihydrochloride.
Molecular Properties
| Compound Name | 3-imidazol-1-ylpyridine;dihydrochloride |
| PubChem CID | 91642740 |
| Molecular Formula | C8H9Cl2N3 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 3-imidazol-1-ylpyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(-n2ccnc2)c1 |
| InChI | InChI=1S/C8H7N3.2ClH/c1-2-8(6-9-3-1)11-5-4-10-7-11;;/h1-7H;2*1H |
| InChIKey | MNQVPKXFVPLOPQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-imidazol-1-ylpyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-ylpyridine;dihydrochloride?
The IUPAC name of 3-imidazol-1-ylpyridine;dihydrochloride (CID 91642740) is 3-imidazol-1-ylpyridine;dihydrochloride.
What is the SMILES notation for 3-imidazol-1-ylpyridine;dihydrochloride?
The canonical SMILES for 3-imidazol-1-ylpyridine;dihydrochloride is Cl.Cl.c1cncc(-n2ccnc2)c1.
What is the InChIKey of 3-imidazol-1-ylpyridine;dihydrochloride?
The InChIKey is MNQVPKXFVPLOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.2ClH/c1-2-8(6-9-3-1)11-5-4-10-7-11;;/h1-7H;2*1H.
What are the key properties of 3-imidazol-1-ylpyridine;dihydrochloride?
3-imidazol-1-ylpyridine;dihydrochloride has a molecular weight of 218.09 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-ylpyridine;dihydrochloride is sourced from PubChem (CID 91642740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).