C15H27NO3 — CID 159347857
(2S)-2-amino-3-cyclopropylpropanoic acid;(3S)-3-(cyclopropylmethyl)pentan-2-one (PubChem CID 159347857) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclopropylpropanoic acid;(3S)-3-(cyclopropylmethyl)pentan-2-one.
| Compound Name | (2S)-2-amino-3-cyclopropylpropanoic acid;(3S)-3-(cyclopropylmethyl)pentan-2-one |
|---|---|
| PubChem CID | 159347857 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2S)-2-amino-3-cyclopropylpropanoic acid;(3S)-3-(cyclopropylmethyl)pentan-2-one |
| SMILES | CCC(CC1CC1)C(C)=O.N[C@@H](CC1CC1)C(=O)O |
| InChI | InChI=1S/C9H16O.C6H11NO2/c1-3-9(7(2)10)6-8-4-5-8;7-5(6(8)9)3-4-1-2-4/h8-9H,3-6H2,1-2H3;4-5H,1-3,7H2,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | LGYKSQUCLJKBKT-ZSCHJXSPSA-N |
| XLogP | 2.60 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |