C32H35FN4O2 — CID 159348148
4-[4-(6-ethyl-3-pyridinyl)phenyl]morpholine;4-[4-(6-fluoro-3-pyridinyl)phenyl]morpholine (PubChem CID 159348148) has the molecular formula C32H35FN4O2 and a molecular weight of 526.66 g/mol. Its IUPAC name is 4-[4-(6-ethyl-3-pyridinyl)phenyl]morpholine;4-[4-(6-fluoro-3-pyridinyl)phenyl]morpholine.
| Compound Name | 4-[4-(6-ethyl-3-pyridinyl)phenyl]morpholine;4-[4-(6-fluoro-3-pyridinyl)phenyl]morpholine |
|---|---|
| PubChem CID | 159348148 |
| Molecular Formula | C32H35FN4O2 |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 4-[4-(6-ethyl-3-pyridinyl)phenyl]morpholine;4-[4-(6-fluoro-3-pyridinyl)phenyl]morpholine |
| SMILES | CCc1ccc(-c2ccc(N3CCOCC3)cc2)cn1.Fc1ccc(-c2ccc(N3CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C17H20N2O.C15H15FN2O/c1-2-16-6-3-15(13-18-16)14-4-7-17(8-5-14)19-9-11-20-12-10-19;16-15-6-3-13(11-17-15)12-1-4-14(5-2-12)18-7-9-19-10-8-18/h3-8,13H,2,9-12H2,1H3;1-6,11H,7-10H2 |
| InChIKey | LGZGOUAKKNFEEG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|