C25H26FN3O — CID 155017064
N-[(3-fluorophenyl)methyl]-3-[5-(4-morpholin-4-ylphenyl)-2-pyridinyl]prop-1-en-2-amine (PubChem CID 155017064) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-[5-(4-morpholin-4-ylphenyl)-2-pyridinyl]prop-1-en-2-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-[5-(4-morpholin-4-ylphenyl)-2-pyridinyl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 155017064 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-[5-(4-morpholin-4-ylphenyl)-2-pyridinyl]prop-1-en-2-amine |
| SMILES | C=C(Cc1ccc(-c2ccc(N3CCOCC3)cc2)cn1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C25H26FN3O/c1-19(27-17-20-3-2-4-23(26)16-20)15-24-8-5-22(18-28-24)21-6-9-25(10-7-21)29-11-13-30-14-12-29/h2-10,16,18,27H,1,11-15,17H2 |
| InChIKey | GEAXPVBJZKQKCV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |