C28H31FN2O2 — CID 123549551
N-[(3-fluorophenyl)methyl]-2-[2-methyl-6-(4-morpholin-4-ylphenyl)cycloocta-1,5,7-trien-1-yl]acetamide (PubChem CID 123549551) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[2-methyl-6-(4-morpholin-4-ylphenyl)cycloocta-1,5,7-trien-1-yl]acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[2-methyl-6-(4-morpholin-4-ylphenyl)cycloocta-1,5,7-trien-1-yl]acetamide |
|---|---|
| PubChem CID | 123549551 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[2-methyl-6-(4-morpholin-4-ylphenyl)cycloocta-1,5,7-trien-1-yl]acetamide |
| SMILES | CC1=C(CC(=O)NCc2cccc(F)c2)C=CC(c2ccc(N3CCOCC3)cc2)=CCC1 |
| InChI | InChI=1S/C28H31FN2O2/c1-21-4-2-6-23(24-10-12-27(13-11-24)31-14-16-33-17-15-31)8-9-25(21)19-28(32)30-20-22-5-3-7-26(29)18-22/h3,5-13,18H,2,4,14-17,19-20H2,1H3,(H,30,32) |
| InChIKey | SQAPYQYWBCELNF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|