C18H27N7O2S — CID 159355043
2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyltetrazole;2,5-dimethyl-1,3-thiazole (PubChem CID 159355043) has the molecular formula C18H27N7O2S and a molecular weight of 405.53 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyltetrazole;2,5-dimethyl-1,3-thiazole.
| Compound Name | 2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyltetrazole;2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 159355043 |
| Molecular Formula | C18H27N7O2S |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyltetrazole;2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1cc(C)on1.Cc1cnc(C)o1.Cc1cnc(C)s1.Cc1nnn(C)n1 |
| InChI | InChI=1S/2C5H7NO.C5H7NS.C3H6N4/c1-4-3-6-5(2)7-4;1-4-3-5(2)7-6-4;1-4-3-6-5(2)7-4;1-3-4-6-7(2)5-3/h3*3H,1-2H3;1-2H3 |
| InChIKey | LHUVXUUACUHULW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 108.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |