C29H41N7O3S3 — CID 160656130
3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,4-dimethyl-1,3-thiazole;bis(3,5-dimethyl-1,2-thiazole) (PubChem CID 160656130) has the molecular formula C29H41N7O3S3 and a molecular weight of 631.89 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,4-dimethyl-1,3-thiazole;bis(3,5-dimethyl-1,2-thiazole).
| Compound Name | 3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,4-dimethyl-1,3-thiazole;bis(3,5-dimethyl-1,2-thiazole) |
|---|---|
| PubChem CID | 160656130 |
| Molecular Formula | C29H41N7O3S3 |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1,2-oxazole;2,4-dimethyl-1,3-thiazole;bis(3,5-dimethyl-1,2-thiazole) |
| SMILES | Cc1cc(C)on1.Cc1cc(C)sn1.Cc1cc(C)sn1.Cc1cnc(C)o1.Cc1csc(C)n1.Cc1noc(C)n1 |
| InChI | InChI=1S/2C5H7NO.3C5H7NS.C4H6N2O/c1-4-3-6-5(2)7-4;1-4-3-5(2)7-6-4;1-4-3-7-5(2)6-4;2*1-4-3-5(2)7-6-4;1-3-5-4(2)7-6-3/h5*3H,1-2H3;1-2H3 |
| InChIKey | RLBMVRWILJNGMI-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |