C19H27N5O2S2 — CID 143924014
3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3-thiazole;3,5-dimethyl-1,2-thiazole (PubChem CID 143924014) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3-thiazole;3,5-dimethyl-1,2-thiazole.
| Compound Name | 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3-thiazole;3,5-dimethyl-1,2-thiazole |
|---|---|
| PubChem CID | 143924014 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3-thiazole;3,5-dimethyl-1,2-thiazole |
| SMILES | Cc1cc(C)on1.Cc1cc(C)sn1.Cc1cnc(C)s1.Cc1noc(C)n1 |
| InChI | InChI=1S/C5H7NO.2C5H7NS.C4H6N2O/c1-4-3-5(2)7-6-4;1-4-3-6-5(2)7-4;1-4-3-5(2)7-6-4;1-3-5-4(2)7-6-3/h3*3H,1-2H3;1-2H3 |
| InChIKey | GQFIYHGBXXXACH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |