C28H48O6 — CID 159355662
acetic acid;3,7-dimethylocta-2,7-dienyl propanoate;(7-methyl-3-methylideneoct-7-enyl) propanoate (PubChem CID 159355662) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is acetic acid;3,7-dimethylocta-2,7-dienyl propanoate;(7-methyl-3-methylideneoct-7-enyl) propanoate.
| Compound Name | acetic acid;3,7-dimethylocta-2,7-dienyl propanoate;(7-methyl-3-methylideneoct-7-enyl) propanoate |
|---|---|
| PubChem CID | 159355662 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | acetic acid;3,7-dimethylocta-2,7-dienyl propanoate;(7-methyl-3-methylideneoct-7-enyl) propanoate |
| SMILES | C=C(C)CCCC(=C)CCOC(=O)CC.C=C(C)CCCC(C)=CCOC(=O)CC.CC(=O)O |
| InChI | InChI=1S/2C13H22O2.C2H4O2/c2*1-5-13(14)15-10-9-12(4)8-6-7-11(2)3;1-2(3)4/h9H,2,5-8,10H2,1,3-4H3;2,4-10H2,1,3H3;1H3,(H,3,4) |
| InChIKey | LHWSFRPINHCJJL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|