C29H28ClN5O6 — CID 159356940
(2S)-N-(4-chlorophenyl)-N-methyl-2-[[2-[4-(4-nitrobenzoyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-phenylpropanamide (PubChem CID 159356940) has the molecular formula C29H28ClN5O6 and a molecular weight of 578.03 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-N-methyl-2-[[2-[4-(4-nitrobenzoyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-N-methyl-2-[[2-[4-(4-nitrobenzoyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 159356940 |
| Molecular Formula | C29H28ClN5O6 |
| Molecular Weight | 578.03 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-N-methyl-2-[[2-[4-(4-nitrobenzoyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-phenylpropanamide |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(=O)CN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClN5O6/c1-32(23-13-9-22(30)10-14-23)29(39)25(17-20-5-3-2-4-6-20)31-26(36)18-33-15-16-34(19-27(33)37)28(38)21-7-11-24(12-8-21)35(40)41/h2-14,25H,15-19H2,1H3,(H,31,36)/t25-/m0/s1 |
| InChIKey | UAKUMZRXUPDXPQ-VWLOTQADSA-N |
| XLogP | 2.92 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.03 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|