C16H13N4O3PS — CID 159358246
[3-[5-(1H-isoindol-5-ylamino)-1,3,4-thiadiazol-2-yl]phenyl]phosphonic acid (PubChem CID 159358246) has the molecular formula C16H13N4O3PS and a molecular weight of 372.35 g/mol. Its IUPAC name is [3-[5-(1H-isoindol-5-ylamino)-1,3,4-thiadiazol-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-[5-(1H-isoindol-5-ylamino)-1,3,4-thiadiazol-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 159358246 |
| Molecular Formula | C16H13N4O3PS |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | [3-[5-(1H-isoindol-5-ylamino)-1,3,4-thiadiazol-2-yl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1cccc(-c2nnc(Nc3ccc4c(c3)C=NC4)s2)c1 |
| InChI | InChI=1S/C16H13N4O3PS/c21-24(22,23)14-3-1-2-10(7-14)15-19-20-16(25-15)18-13-5-4-11-8-17-9-12(11)6-13/h1-7,9H,8H2,(H,18,20)(H2,21,22,23) |
| InChIKey | LIEUFUJZFPOUEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|