C29H53N3O2S2 — CID 159360435
N-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxo-11-sulfanylundecanamide;heptan-1-amine (PubChem CID 159360435) has the molecular formula C29H53N3O2S2 and a molecular weight of 539.90 g/mol. Its IUPAC name is N-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxo-11-sulfanylundecanamide;heptan-1-amine.
| Compound Name | N-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxo-11-sulfanylundecanamide;heptan-1-amine |
|---|---|
| PubChem CID | 159360435 |
| Molecular Formula | C29H53N3O2S2 |
| Molecular Weight | 539.90 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | N-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxo-11-sulfanylundecanamide;heptan-1-amine |
| SMILES | CCCCCCCN.CCCC[C@H]1CCc2nc(NC(=O)CCC(=O)CCCCCCCS)sc2C1 |
| InChI | InChI=1S/C22H36N2O2S2.C7H17N/c1-2-3-9-17-11-13-19-20(16-17)28-22(23-19)24-21(26)14-12-18(25)10-7-5-4-6-8-15-27;1-2-3-4-5-6-7-8/h17,27H,2-16H2,1H3,(H,23,24,26);2-8H2,1H3/t17-;/m0./s1 |
| InChIKey | LILVINONUAUUFE-LMOVPXPDSA-N |
| XLogP | 7.91 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.90 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|