C37H57N3O2S — CID 160819443
(5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-[[(6R)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 160819443) has the molecular formula C37H57N3O2S and a molecular weight of 607.95 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-[[(6R)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-[[(6R)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 160819443 |
| Molecular Formula | C37H57N3O2S |
| Molecular Weight | 607.95 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-[[(6R)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](CC(C)C)C(=O)Nc1nc2c(s1)C[C@H](CCCC)CC2 |
| InChI | InChI=1S/C37H57N3O2S/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-35(41)38-33(28-30(3)4)36(42)40-37-39-32-27-26-31(24-8-6-2)29-34(32)43-37/h7,9,11-12,14-15,17-18,20-21,30-31,33H,5-6,8,10,13,16,19,22-29H2,1-4H3,(H,38,41)(H,39,40,42)/b9-7-,12-11-,15-14-,18-17-,21-20-/t31-,33+/m1/s1 |
| InChIKey | RSXPIBQKYVUKCX-KSTOYFSKSA-N |
| XLogP | 9.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.95 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|