C12H22N2O3 — CID 159361776
(E)-N-[2-(2-acetamidoethoxy)ethyl]-4-methylpent-2-enamide (PubChem CID 159361776) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (E)-N-[2-(2-acetamidoethoxy)ethyl]-4-methylpent-2-enamide.
| Compound Name | (E)-N-[2-(2-acetamidoethoxy)ethyl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 159361776 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (E)-N-[2-(2-acetamidoethoxy)ethyl]-4-methylpent-2-enamide |
| SMILES | CC(=O)NCCOCCNC(=O)/C=C/C(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-10(2)4-5-12(16)14-7-9-17-8-6-13-11(3)15/h4-5,10H,6-9H2,1-3H3,(H,13,15)(H,14,16)/b5-4+ |
| InChIKey | LIQBVGOOJRIQJK-SNAWJCMRSA-N |
| XLogP | 0.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|