About 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide
2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide (PubChem CID 159364916) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide.
Molecular Properties
| Compound Name | 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide |
| PubChem CID | 159364916 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide |
| SMILES | CNc1ccccc1-c1cc(-c2ccco2)[nH]n1.O=S=O |
| InChI | InChI=1S/C14H13N3O.O2S/c1-15-11-6-3-2-5-10(11)12-9-13(17-16-12)14-7-4-8-18-14;1-3-2/h2-9,15H,1H3,(H,16,17); |
| InChIKey | LIZUBZYBNWOFRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide?
The IUPAC name of 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide (CID 159364916) is 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide.
What is the SMILES notation for 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide?
The canonical SMILES for 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide is CNc1ccccc1-c1cc(-c2ccco2)[nH]n1.O=S=O.
What is the InChIKey of 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide?
The InChIKey is LIZUBZYBNWOFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O.O2S/c1-15-11-6-3-2-5-10(11)12-9-13(17-16-12)14-7-4-8-18-14;1-3-2/h2-9,15H,1H3,(H,16,17);.
What are the key properties of 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide?
2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide has a molecular weight of 303.34 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]-N-methylaniline;sulfur dioxide is sourced from PubChem (CID 159364916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).