C12H13NO — CID 145268852
2-(furan-2-yl)-N,4-dimethylaniline (PubChem CID 145268852) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(furan-2-yl)-N,4-dimethylaniline.
| Compound Name | 2-(furan-2-yl)-N,4-dimethylaniline |
|---|---|
| PubChem CID | 145268852 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(furan-2-yl)-N,4-dimethylaniline |
| SMILES | CNc1ccc(C)cc1-c1ccco1 |
| InChI | InChI=1S/C12H13NO/c1-9-5-6-11(13-2)10(8-9)12-4-3-7-14-12/h3-8,13H,1-2H3 |
| InChIKey | XEIOIXWWEDXEMB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |