C18H20N3+ — CID 159365880
1-[2,5-dimethyl-3-(2-methylpyrazol-3-yl)phenyl]-2-methylpyridin-1-ium (PubChem CID 159365880) has the molecular formula C18H20N3+ and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-[2,5-dimethyl-3-(2-methylpyrazol-3-yl)phenyl]-2-methylpyridin-1-ium.
| Compound Name | 1-[2,5-dimethyl-3-(2-methylpyrazol-3-yl)phenyl]-2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 159365880 |
| Molecular Formula | C18H20N3+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[2,5-dimethyl-3-(2-methylpyrazol-3-yl)phenyl]-2-methylpyridin-1-ium |
| SMILES | Cc1cc(-c2ccnn2C)c(C)c(-[n+]2ccccc2C)c1 |
| InChI | InChI=1S/C18H20N3/c1-13-11-16(17-8-9-19-20(17)4)15(3)18(12-13)21-10-6-5-7-14(21)2/h5-12H,1-4H3/q+1 |
| InChIKey | UMSUEYSEGUJGLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|