About 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate
5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate (PubChem CID 159366219) has the molecular formula C20H27NO5
and a molecular weight of 361.44 g/mol. Its IUPAC name is 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate |
| PubChem CID | 159366219 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@H]1C.COc1ccc2oc(C(N)=O)cc2c1 |
| InChI | InChI=1S/C10H9NO3.C10H18O2/c1-13-7-2-3-8-6(4-7)5-9(14-8)10(11)12;1-3-12-10(11)9-7-5-4-6-8(9)2/h2-5H,1H3,(H2,11,12);8-9H,3-7H2,1-2H3/t;8-,9-/m.1/s1 |
| InChIKey | LJDTZURPONNKCE-LNKMSKNTSA-N |
| XLogP | 3.92 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate?
The IUPAC name of 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate (CID 159366219) is 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate.
What is the SMILES notation for 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate?
The canonical SMILES for 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate is CCOC(=O)[C@@H]1CCCC[C@H]1C.COc1ccc2oc(C(N)=O)cc2c1.
What is the InChIKey of 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate?
The InChIKey is LJDTZURPONNKCE-LNKMSKNTSA-N. The full InChI is InChI=1S/C10H9NO3.C10H18O2/c1-13-7-2-3-8-6(4-7)5-9(14-8)10(11)12;1-3-12-10(11)9-7-5-4-6-8(9)2/h2-5H,1H3,(H2,11,12);8-9H,3-7H2,1-2H3/t;8-,9-/m.1/s1.
What are the key properties of 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate?
5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate has a molecular weight of 361.44 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-benzofuran-2-carboxamide;trans-ethyl (1R,2R)-2-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 159366219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).