C16H19N3O5 — CID 175133699
[1-[(5-methoxy-1-benzofuran-2-carbonyl)amino]piperidin-4-yl] carbamate (PubChem CID 175133699) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is [1-[(5-methoxy-1-benzofuran-2-carbonyl)amino]piperidin-4-yl] carbamate.
| Compound Name | [1-[(5-methoxy-1-benzofuran-2-carbonyl)amino]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175133699 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [1-[(5-methoxy-1-benzofuran-2-carbonyl)amino]piperidin-4-yl] carbamate |
| SMILES | COc1ccc2oc(C(=O)NN3CCC(OC(N)=O)CC3)cc2c1 |
| InChI | InChI=1S/C16H19N3O5/c1-22-12-2-3-13-10(8-12)9-14(24-13)15(20)18-19-6-4-11(5-7-19)23-16(17)21/h2-3,8-9,11H,4-7H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | ZOGWQFRLLSUBLL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |