C26H22F3N5O2 — CID 159371830
11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one (PubChem CID 159371830) has the molecular formula C26H22F3N5O2 and a molecular weight of 493.49 g/mol. Its IUPAC name is 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one.
| Compound Name | 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 159371830 |
| Molecular Formula | C26H22F3N5O2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
| SMILES | Cc1[nH]nc2nc(-c3ccc(O)c(C(F)(F)F)c3)c3c(=O)[nH]c4cc(N5CCCCC5)ccc4c3c12 |
| InChI | InChI=1S/C26H22F3N5O2/c1-13-20-21-16-7-6-15(34-9-3-2-4-10-34)12-18(16)30-25(36)22(21)23(31-24(20)33-32-13)14-5-8-19(35)17(11-14)26(27,28)29/h5-8,11-12,35H,2-4,9-10H2,1H3,(H,30,36)(H,31,32,33) |
| InChIKey | LJVOQHMPYRGFBD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|