About 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole
2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole (PubChem CID 159379204) has the molecular formula C16H16Cl2N2S
and a molecular weight of 339.29 g/mol. Its IUPAC name is 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole.
Molecular Properties
| Compound Name | 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole |
| PubChem CID | 159379204 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole |
| SMILES | CSc1c(C)[nH]c2c(Cl)cccc12.Nc1ccccc1Cl |
| InChI | InChI=1S/C10H10ClNS.C6H6ClN/c1-6-10(13-2)7-4-3-5-8(11)9(7)12-6;7-5-3-1-2-4-6(5)8/h3-5,12H,1-2H3;1-4H,8H2 |
| InChIKey | LKROWARTCLARPL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole?
The IUPAC name of 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole (CID 159379204) is 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole.
What is the SMILES notation for 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole?
The canonical SMILES for 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole is CSc1c(C)[nH]c2c(Cl)cccc12.Nc1ccccc1Cl.
What is the InChIKey of 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole?
The InChIKey is LKROWARTCLARPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNS.C6H6ClN/c1-6-10(13-2)7-4-3-5-8(11)9(7)12-6;7-5-3-1-2-4-6(5)8/h3-5,12H,1-2H3;1-4H,8H2.
What are the key properties of 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole?
2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole has a molecular weight of 339.29 g/mol, XLogP of 5.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroaniline;7-chloro-2-methyl-3-methylsulfanyl-1H-indole is sourced from PubChem (CID 159379204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).