C28H28FN3O — CID 159379240
3-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-amino-1-(6-ethynyl-3-pyridinyl)butan-2-one (PubChem CID 159379240) has the molecular formula C28H28FN3O and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-amino-1-(6-ethynyl-3-pyridinyl)butan-2-one.
| Compound Name | 3-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-amino-1-(6-ethynyl-3-pyridinyl)butan-2-one |
|---|---|
| PubChem CID | 159379240 |
| Molecular Formula | C28H28FN3O |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-amino-1-(6-ethynyl-3-pyridinyl)butan-2-one |
| SMILES | C#Cc1ccc(CC(=O)C(C)(N)C2C[C@H]3CC(c4ccnc5ccc(F)cc45)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C28H28FN3O/c1-3-23-6-4-17(16-32-23)10-27(33)28(2,30)21-13-18-11-20(12-19(18)14-21)24-8-9-31-26-7-5-22(29)15-25(24)26/h1,4-9,15-16,18-21H,10-14,30H2,2H3/t18-,19+,20?,21?,28? |
| InChIKey | YZOBRZCOIHJSAS-JDISCMMASA-N |
| XLogP | 4.80 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|