C26H24FN3O2 — CID 155016531
N-(6-ethynyl-3-pyridinyl)-2-[5-(6-fluoroquinolin-4-yl)-2-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]acetamide (PubChem CID 155016531) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-(6-ethynyl-3-pyridinyl)-2-[5-(6-fluoroquinolin-4-yl)-2-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]acetamide.
| Compound Name | N-(6-ethynyl-3-pyridinyl)-2-[5-(6-fluoroquinolin-4-yl)-2-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]acetamide |
|---|---|
| PubChem CID | 155016531 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-(6-ethynyl-3-pyridinyl)-2-[5-(6-fluoroquinolin-4-yl)-2-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]acetamide |
| SMILES | C#Cc1ccc(NC(=O)CC2(O)CC3CC(c4ccnc5ccc(F)cc45)CC3C2)cn1 |
| InChI | InChI=1S/C26H24FN3O2/c1-2-20-4-5-21(15-29-20)30-25(31)14-26(32)12-17-9-16(10-18(17)13-26)22-7-8-28-24-6-3-19(27)11-23(22)24/h1,3-8,11,15-18,32H,9-10,12-14H2,(H,30,31) |
| InChIKey | XCBYZCBCRVUEJD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|