C22H27FN2O — CID 155016706
2-[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-methylacetamide (PubChem CID 155016706) has the molecular formula C22H27FN2O and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-methylacetamide.
| Compound Name | 2-[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 155016706 |
| Molecular Formula | C22H27FN2O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1C[C@@]2(C)CC(c3ccnc4ccc(F)cc34)C[C@@]2(C)C1 |
| InChI | InChI=1S/C22H27FN2O/c1-21-10-14(8-20(26)24-3)11-22(21,2)13-15(12-21)17-6-7-25-19-5-4-16(23)9-18(17)19/h4-7,9,14-15H,8,10-13H2,1-3H3,(H,24,26)/t14?,15?,21-,22+ |
| InChIKey | CIXAZCBPISFROW-AOBWGYNQSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |