C23H27F3N2O — CID 155087973
2-[(2S,3aR,5R,6aR)-6,6-difluoro-5-(6-fluoroquinolin-4-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-N-tert-butylacetamide (PubChem CID 155087973) has the molecular formula C23H27F3N2O and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[(2S,3aR,5R,6aR)-6,6-difluoro-5-(6-fluoroquinolin-4-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-N-tert-butylacetamide.
| Compound Name | 2-[(2S,3aR,5R,6aR)-6,6-difluoro-5-(6-fluoroquinolin-4-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 155087973 |
| Molecular Formula | C23H27F3N2O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(2S,3aR,5R,6aR)-6,6-difluoro-5-(6-fluoroquinolin-4-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)C[C@H]1C[C@@H]2C[C@H](c3ccnc4ccc(F)cc34)C(F)(F)[C@@H]2C1 |
| InChI | InChI=1S/C23H27F3N2O/c1-22(2,3)28-21(29)10-13-8-14-11-19(23(25,26)18(14)9-13)16-6-7-27-20-5-4-15(24)12-17(16)20/h4-7,12-14,18-19H,8-11H2,1-3H3,(H,28,29)/t13-,14+,18+,19+/m0/s1 |
| InChIKey | PLGCERDPMVSXSG-WTVLQJKYSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |