C25H33FN2O — CID 155087807
2-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-tert-butylacetamide (PubChem CID 155087807) has the molecular formula C25H33FN2O and a molecular weight of 396.55 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-tert-butylacetamide.
| Compound Name | 2-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 155087807 |
| Molecular Formula | C25H33FN2O |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(3aR,6aS)-5-(6-fluoroquinolin-4-yl)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydropentalen-2-yl]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CC1C[C@@]2(C)CC(c3ccnc4ccc(F)cc34)C[C@@]2(C)C1 |
| InChI | InChI=1S/C25H33FN2O/c1-23(2,3)28-22(29)10-16-12-24(4)14-17(15-25(24,5)13-16)19-8-9-27-21-7-6-18(26)11-20(19)21/h6-9,11,16-17H,10,12-15H2,1-5H3,(H,28,29)/t16?,17?,24-,25+ |
| InChIKey | TYVPDBYAXOUIEQ-KOPLNGCFSA-N |
| XLogP | 5.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |