C22H34N2O8S — CID 159383145
tert-butyl (2S)-2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate;tert-butyl (2S)-2-formyl-5-oxopyrrolidine-1-carboxylate (PubChem CID 159383145) has the molecular formula C22H34N2O8S and a molecular weight of 486.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate;tert-butyl (2S)-2-formyl-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate;tert-butyl (2S)-2-formyl-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159383145 |
| Molecular Formula | C22H34N2O8S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | tert-butyl (2S)-2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate;tert-butyl (2S)-2-formyl-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@H]1C=O.CCSC(=O)[C@@H]1CCC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO4S.C10H15NO4/c1-5-18-10(15)8-6-7-9(14)13(8)11(16)17-12(2,3)4;1-10(2,3)15-9(14)11-7(6-12)4-5-8(11)13/h8H,5-7H2,1-4H3;6-7H,4-5H2,1-3H3/t8-;7-/m00/s1 |
| InChIKey | LLDXUJDXQHXATA-GZTXQBDSSA-N |
| XLogP | 3.30 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|