About 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane
4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane (PubChem CID 159387138) has the molecular formula C29H53NO
and a molecular weight of 431.75 g/mol. Its IUPAC name is 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane.
Molecular Properties
| Compound Name | 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane |
| PubChem CID | 159387138 |
| Molecular Formula | C29H53NO |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.41 |
| IUPAC Name | 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane |
| SMILES | C1CCCC1.CC(C)(C)C1CC=C(N2CCCC2)CC1.CC(C)(C)C1CCC(=O)CC1 |
| InChI | InChI=1S/C14H25N.C10H18O.C5H10/c1-14(2,3)12-6-8-13(9-7-12)15-10-4-5-11-15;1-10(2,3)8-4-6-9(11)7-5-8;1-2-4-5-3-1/h8,12H,4-7,9-11H2,1-3H3;8H,4-7H2,1-3H3;1-5H2 |
| InChIKey | LLQHZSJJULAUSI-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane?
The IUPAC name of 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane (CID 159387138) is 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane.
What is the SMILES notation for 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane?
The canonical SMILES for 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane is C1CCCC1.CC(C)(C)C1CC=C(N2CCCC2)CC1.CC(C)(C)C1CCC(=O)CC1.
What is the InChIKey of 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane?
The InChIKey is LLQHZSJJULAUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N.C10H18O.C5H10/c1-14(2,3)12-6-8-13(9-7-12)15-10-4-5-11-15;1-10(2,3)8-4-6-9(11)7-5-8;1-2-4-5-3-1/h8,12H,4-7,9-11H2,1-3H3;8H,4-7H2,1-3H3;1-5H2.
What are the key properties of 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane?
4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane has a molecular weight of 431.75 g/mol, XLogP of 8.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylcyclohexan-1-one;1-(4-tert-butylcyclohexen-1-yl)pyrrolidine;cyclopentane is sourced from PubChem (CID 159387138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).