C12H22O2 — CID 15939184
1-[(3S)-3-hydroxy-4,4-dimethylpent-1-en-2-yl]cyclopentan-1-ol (PubChem CID 15939184) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(3S)-3-hydroxy-4,4-dimethylpent-1-en-2-yl]cyclopentan-1-ol.
| Compound Name | 1-[(3S)-3-hydroxy-4,4-dimethylpent-1-en-2-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 15939184 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-[(3S)-3-hydroxy-4,4-dimethylpent-1-en-2-yl]cyclopentan-1-ol |
| SMILES | C=C([C@@H](O)C(C)(C)C)C1(O)CCCC1 |
| InChI | InChI=1S/C12H22O2/c1-9(10(13)11(2,3)4)12(14)7-5-6-8-12/h10,13-14H,1,5-8H2,2-4H3/t10-/m1/s1 |
| InChIKey | VUFPPRUJAVYITL-SNVBAGLBSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|