C14H17NO4 — CID 15939288
methyl (2S,3aS)-3a-phenyl-3,5,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine-2-carboxylate (PubChem CID 15939288) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl (2S,3aS)-3a-phenyl-3,5,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine-2-carboxylate.
| Compound Name | methyl (2S,3aS)-3a-phenyl-3,5,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine-2-carboxylate |
|---|---|
| PubChem CID | 15939288 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (2S,3aS)-3a-phenyl-3,5,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(c3ccccc3)OCCCN2O1 |
| InChI | InChI=1S/C14H17NO4/c1-17-13(16)12-10-14(11-6-3-2-4-7-11)15(19-12)8-5-9-18-14/h2-4,6-7,12H,5,8-10H2,1H3/t12-,14-/m0/s1 |
| InChIKey | HXONGGUAAZXMOJ-JSGCOSHPSA-N |
| XLogP | 1.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |