C23H27NO6 — CID 10740455
dimethyl (4R)-2-benzyl-4-[(1S)-1-phenylmethoxyethyl]-1,2-oxazolidine-5,5-dicarboxylate (PubChem CID 10740455) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is dimethyl (4R)-2-benzyl-4-[(1S)-1-phenylmethoxyethyl]-1,2-oxazolidine-5,5-dicarboxylate.
| Compound Name | dimethyl (4R)-2-benzyl-4-[(1S)-1-phenylmethoxyethyl]-1,2-oxazolidine-5,5-dicarboxylate |
|---|---|
| PubChem CID | 10740455 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | dimethyl (4R)-2-benzyl-4-[(1S)-1-phenylmethoxyethyl]-1,2-oxazolidine-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)ON(Cc2ccccc2)C[C@@H]1[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO6/c1-17(29-16-19-12-8-5-9-13-19)20-15-24(14-18-10-6-4-7-11-18)30-23(20,21(25)27-2)22(26)28-3/h4-13,17,20H,14-16H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | ABKQKMQOAWKUTA-FXAWDEMLSA-N |
| XLogP | 2.74 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|