C5H5F6N3 — CID 159394097
3,5-bis(trifluoromethyl)-1H-1,2,4-triazole;methane (PubChem CID 159394097) has the molecular formula C5H5F6N3 and a molecular weight of 221.10 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1H-1,2,4-triazole;methane.
| Compound Name | 3,5-bis(trifluoromethyl)-1H-1,2,4-triazole;methane |
|---|---|
| PubChem CID | 159394097 |
| Molecular Formula | C5H5F6N3 |
| Molecular Weight | 221.10 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1H-1,2,4-triazole;methane |
| SMILES | C.FC(F)(F)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C4HF6N3.CH4/c5-3(6,7)1-11-2(13-12-1)4(8,9)10;/h(H,11,12,13);1H4 |
| InChIKey | LMMMAOCSJURRTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |