C15H25NO — CID 15939796
(2S,5R,6E)-6-[(8aS)-2,3,5,8a-tetrahydro-1H-indolizin-6-ylidene]-5-methylhexan-2-ol (PubChem CID 15939796) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2S,5R,6E)-6-[(8aS)-2,3,5,8a-tetrahydro-1H-indolizin-6-ylidene]-5-methylhexan-2-ol.
| Compound Name | (2S,5R,6E)-6-[(8aS)-2,3,5,8a-tetrahydro-1H-indolizin-6-ylidene]-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 15939796 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2S,5R,6E)-6-[(8aS)-2,3,5,8a-tetrahydro-1H-indolizin-6-ylidene]-5-methylhexan-2-ol |
| SMILES | C[C@H](O)CC[C@@H](C)/C=C1\C=C[C@@H]2CCCN2C1 |
| InChI | InChI=1S/C15H25NO/c1-12(5-6-13(2)17)10-14-7-8-15-4-3-9-16(15)11-14/h7-8,10,12-13,15,17H,3-6,9,11H2,1-2H3/b14-10+/t12-,13+,15+/m1/s1 |
| InChIKey | AYXNBUOZKHOIPL-LEORGFTDSA-N |
| XLogP | 2.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |