C22H38N2O11S — CID 159399275
2-[3-(1-carboxybutylamino)-3-oxopropyl]-5-[2-[2-(4-methylsulfonylbutanoylamino)ethoxy]ethoxy]-4-oxopentanoic acid (PubChem CID 159399275) has the molecular formula C22H38N2O11S and a molecular weight of 538.62 g/mol. Its IUPAC name is 2-[3-(1-carboxybutylamino)-3-oxopropyl]-5-[2-[2-(4-methylsulfonylbutanoylamino)ethoxy]ethoxy]-4-oxopentanoic acid.
| Compound Name | 2-[3-(1-carboxybutylamino)-3-oxopropyl]-5-[2-[2-(4-methylsulfonylbutanoylamino)ethoxy]ethoxy]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 159399275 |
| Molecular Formula | C22H38N2O11S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[3-(1-carboxybutylamino)-3-oxopropyl]-5-[2-[2-(4-methylsulfonylbutanoylamino)ethoxy]ethoxy]-4-oxopentanoic acid |
| SMILES | CCCC(NC(=O)CCC(CC(=O)COCCOCCNC(=O)CCCS(C)(=O)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H38N2O11S/c1-3-5-18(22(30)31)24-20(27)8-7-16(21(28)29)14-17(25)15-35-12-11-34-10-9-23-19(26)6-4-13-36(2,32)33/h16,18H,3-15H2,1-2H3,(H,23,26)(H,24,27)(H,28,29)(H,30,31) |
| InChIKey | WDMZMMMNDNYRHS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 202.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|