C23H20F2N4+2 — CID 159399308
1-[2,4-difluoro-3-methyl-5-(3-methylbenzimidazol-3-ium-1-yl)phenyl]-3-methylbenzimidazol-3-ium (PubChem CID 159399308) has the molecular formula C23H20F2N4+2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[2,4-difluoro-3-methyl-5-(3-methylbenzimidazol-3-ium-1-yl)phenyl]-3-methylbenzimidazol-3-ium.
| Compound Name | 1-[2,4-difluoro-3-methyl-5-(3-methylbenzimidazol-3-ium-1-yl)phenyl]-3-methylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 159399308 |
| Molecular Formula | C23H20F2N4+2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[2,4-difluoro-3-methyl-5-(3-methylbenzimidazol-3-ium-1-yl)phenyl]-3-methylbenzimidazol-3-ium |
| SMILES | Cc1c(F)c(-n2c[n+](C)c3ccccc32)cc(-n2c[n+](C)c3ccccc32)c1F |
| InChI | InChI=1S/C23H20F2N4/c1-15-22(24)20(28-13-26(2)16-8-4-6-10-18(16)28)12-21(23(15)25)29-14-27(3)17-9-5-7-11-19(17)29/h4-14H,1-3H3/q+2 |
| InChIKey | VFRJULANGYPLOQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|