C22H23ClFN5O6S — CID 159401140
[(1R,2R,3S,4S)-4-[[5-[1-[(3-chloro-5-fluorophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]methyl]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 159401140) has the molecular formula C22H23ClFN5O6S and a molecular weight of 539.97 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-[[5-[1-[(3-chloro-5-fluorophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]methyl]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4S)-4-[[5-[1-[(3-chloro-5-fluorophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]methyl]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 159401140 |
| Molecular Formula | C22H23ClFN5O6S |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | [(1R,2R,3S,4S)-4-[[5-[1-[(3-chloro-5-fluorophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]methyl]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Cc2ncncc2C(=O)c2ccn(Cc3cc(F)cc(Cl)c3)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H23ClFN5O6S/c23-15-3-12(4-16(24)7-15)9-29-2-1-18(28-29)22(32)17-8-26-11-27-19(17)6-13-5-14(21(31)20(13)30)10-35-36(25,33)34/h1-4,7-8,11,13-14,20-21,30-31H,5-6,9-10H2,(H2,25,33,34)/t13-,14+,20-,21+/m0/s1 |
| InChIKey | PBEFPTPWZSULBY-GDMOEJLQSA-N |
| XLogP | 0.87 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |