C33H40BBrN8O4 — CID 159402326
tert-butyl 6-bromoindazole-1-carboxylate;6-(1-methylpyrazol-4-yl)-1H-indazole;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 159402326) has the molecular formula C33H40BBrN8O4 and a molecular weight of 703.45 g/mol. Its IUPAC name is tert-butyl 6-bromoindazole-1-carboxylate;6-(1-methylpyrazol-4-yl)-1H-indazole;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | tert-butyl 6-bromoindazole-1-carboxylate;6-(1-methylpyrazol-4-yl)-1H-indazole;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 159402326 |
| Molecular Formula | C33H40BBrN8O4 |
| Molecular Weight | 703.45 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | tert-butyl 6-bromoindazole-1-carboxylate;6-(1-methylpyrazol-4-yl)-1H-indazole;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC(C)(C)OC(=O)n1ncc2ccc(Br)cc21.Cn1cc(-c2ccc3cn[nH]c3c2)cn1.Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C12H13BrN2O2.C11H10N4.C10H17BN2O2/c1-12(2,3)17-11(16)15-10-6-9(13)5-4-8(10)7-14-15;1-15-7-10(6-13-15)8-2-3-9-5-12-14-11(9)4-8;1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8/h4-7H,1-3H3;2-7H,1H3,(H,12,14);6-7H,1-5H3 |
| InChIKey | LNMQEAFYAVJQQO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|