C45H42BBrN8O2 — CID 161485425
6-bromo-1H-indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;6-(1-tritylpyrazol-4-yl)-1H-indazole (PubChem CID 161485425) has the molecular formula C45H42BBrN8O2 and a molecular weight of 817.60 g/mol. Its IUPAC name is 6-bromo-1H-indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;6-(1-tritylpyrazol-4-yl)-1H-indazole.
| Compound Name | 6-bromo-1H-indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;6-(1-tritylpyrazol-4-yl)-1H-indazole |
|---|---|
| PubChem CID | 161485425 |
| Molecular Formula | C45H42BBrN8O2 |
| Molecular Weight | 817.60 g/mol |
| Exact Mass | 816.27 |
| IUPAC Name | 6-bromo-1H-indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;6-(1-tritylpyrazol-4-yl)-1H-indazole |
| SMILES | Brc1ccc2cn[nH]c2c1.CC1(C)OB(c2cn[nH]c2)OC1(C)C.c1ccc(C(c2ccccc2)(c2ccccc2)n2cc(-c3ccc4cn[nH]c4c3)cn2)cc1 |
| InChI | InChI=1S/C29H22N4.C9H15BN2O2.C7H5BrN2/c1-4-10-25(11-5-1)29(26-12-6-2-7-13-26,27-14-8-3-9-15-27)33-21-24(20-31-33)22-16-17-23-19-30-32-28(23)18-22;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7;8-6-2-1-5-4-9-10-7(5)3-6/h1-21H,(H,30,32);5-6H,1-4H3,(H,11,12);1-4H,(H,9,10) |
| InChIKey | WEXKACSZGWMDNC-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.60 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|