C36H38BBrF4N6O2 — CID 159074121
(4-bromo-2,6-difluorophenyl)methanamine;[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 159074121) has the molecular formula C36H38BBrF4N6O2 and a molecular weight of 753.45 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)methanamine;[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | (4-bromo-2,6-difluorophenyl)methanamine;[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 159074121 |
| Molecular Formula | C36H38BBrF4N6O2 |
| Molecular Weight | 753.45 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)methanamine;[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc2c(-c3cc(F)c(CN)c(F)c3)cccc2n1.Cn1cc2c(B3OC(C)(C)C(C)(C)O3)cccc2n1.NCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H13F2N3.C14H19BN2O2.C7H6BrF2N/c1-20-8-12-10(3-2-4-15(12)19-20)9-5-13(16)11(7-18)14(17)6-9;1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-17(5)16-12;8-4-1-6(9)5(3-11)7(10)2-4/h2-6,8H,7,18H2,1H3;6-9H,1-5H3;1-2H,3,11H2 |
| InChIKey | KAAPKVVWGSRZCD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.45 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|