C24H30BBrN4O2 — CID 159628051
5-bromo-1,6-dimethylindazole;1,6-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 159628051) has the molecular formula C24H30BBrN4O2 and a molecular weight of 497.25 g/mol. Its IUPAC name is 5-bromo-1,6-dimethylindazole;1,6-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-1,6-dimethylindazole;1,6-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 159628051 |
| Molecular Formula | C24H30BBrN4O2 |
| Molecular Weight | 497.25 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 5-bromo-1,6-dimethylindazole;1,6-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cc1cc2c(cnn2C)cc1B1OC(C)(C)C(C)(C)O1.Cc1cc2c(cnn2C)cc1Br |
| InChI | InChI=1S/C15H21BN2O2.C9H9BrN2/c1-10-7-13-11(9-17-18(13)6)8-12(10)16-19-14(2,3)15(4,5)20-16;1-6-3-9-7(4-8(6)10)5-11-12(9)2/h7-9H,1-6H3;3-5H,1-2H3 |
| InChIKey | MOTJCPQJVBQINN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|