C44H38BBrN10O2 — CID 161315724
5-bromopyridin-3-amine;5-[1-(3-isocyanophenyl)indazol-6-yl]pyridin-3-amine;1-(3-isocyanophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 161315724) has the molecular formula C44H38BBrN10O2 and a molecular weight of 829.57 g/mol. Its IUPAC name is 5-bromopyridin-3-amine;5-[1-(3-isocyanophenyl)indazol-6-yl]pyridin-3-amine;1-(3-isocyanophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromopyridin-3-amine;5-[1-(3-isocyanophenyl)indazol-6-yl]pyridin-3-amine;1-(3-isocyanophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 161315724 |
| Molecular Formula | C44H38BBrN10O2 |
| Molecular Weight | 829.57 g/mol |
| Exact Mass | 828.25 |
| IUPAC Name | 5-bromopyridin-3-amine;5-[1-(3-isocyanophenyl)indazol-6-yl]pyridin-3-amine;1-(3-isocyanophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Nc1cncc(Br)c1.[C-]#[N+]c1cccc(-n2ncc3ccc(-c4cncc(N)c4)cc32)c1.[C-]#[N+]c1cccc(-n2ncc3ccc(B4OC(C)(C)C(C)(C)O4)cc32)c1 |
| InChI | InChI=1S/C20H20BN3O2.C19H13N5.C5H5BrN2/c1-19(2)20(3,4)26-21(25-19)15-10-9-14-13-23-24(18(14)11-15)17-8-6-7-16(12-17)22-5;1-21-17-3-2-4-18(9-17)24-19-8-13(5-6-14(19)11-23-24)15-7-16(20)12-22-10-15;6-4-1-5(7)3-8-2-4/h6-13H,1-4H3;2-12H,20H2;1-3H,7H2 |
| InChIKey | VJLVIQAFALBDNV-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.57 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|