C23H26O3S — CID 159402633
1-[1-(cyclopropylmethylsulfonyl)propan-2-yl]-4-[2-(4-ethoxyphenyl)ethynyl]benzene (PubChem CID 159402633) has the molecular formula C23H26O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethylsulfonyl)propan-2-yl]-4-[2-(4-ethoxyphenyl)ethynyl]benzene.
| Compound Name | 1-[1-(cyclopropylmethylsulfonyl)propan-2-yl]-4-[2-(4-ethoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 159402633 |
| Molecular Formula | C23H26O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[1-(cyclopropylmethylsulfonyl)propan-2-yl]-4-[2-(4-ethoxyphenyl)ethynyl]benzene |
| SMILES | CCOc1ccc(C#Cc2ccc(C(C)CS(=O)(=O)CC3CC3)cc2)cc1 |
| InChI | InChI=1S/C23H26O3S/c1-3-26-23-14-10-20(11-15-23)5-4-19-8-12-22(13-9-19)18(2)16-27(24,25)17-21-6-7-21/h8-15,18,21H,3,6-7,16-17H2,1-2H3 |
| InChIKey | LNNSBESFLAVXJI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|