C24H25F3O3 — CID 148789418
5-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]-2-(2,2,2-trifluoroethoxy)hexan-3-one (PubChem CID 148789418) has the molecular formula C24H25F3O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]-2-(2,2,2-trifluoroethoxy)hexan-3-one.
| Compound Name | 5-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]-2-(2,2,2-trifluoroethoxy)hexan-3-one |
|---|---|
| PubChem CID | 148789418 |
| Molecular Formula | C24H25F3O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 5-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]-2-(2,2,2-trifluoroethoxy)hexan-3-one |
| SMILES | CCOc1ccc(C#Cc2ccc(C(C)CC(=O)C(C)OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H25F3O3/c1-4-29-22-13-9-20(10-14-22)6-5-19-7-11-21(12-8-19)17(2)15-23(28)18(3)30-16-24(25,26)27/h7-14,17-18H,4,15-16H2,1-3H3 |
| InChIKey | OLWCSYNNPSGDGO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|