C11H11F5O2 — CID 61100045
1-(4-ethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 61100045) has the molecular formula C11H11F5O2 and a molecular weight of 270.20 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(4-ethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 61100045 |
| Molecular Formula | C11H11F5O2 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | CCOc1ccc(C(O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F5O2/c1-2-18-8-5-3-7(4-6-8)9(17)10(12,13)11(14,15)16/h3-6,9,17H,2H2,1H3 |
| InChIKey | LSHVBIKYNPFXNP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|