C20H16ClF2N3O3S — CID 159402867
N-[4-[6-chloro-5-[(2,5-difluorophenyl)sulfonylmethyl]-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide (PubChem CID 159402867) has the molecular formula C20H16ClF2N3O3S and a molecular weight of 451.88 g/mol. Its IUPAC name is N-[4-[6-chloro-5-[(2,5-difluorophenyl)sulfonylmethyl]-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[6-chloro-5-[(2,5-difluorophenyl)sulfonylmethyl]-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 159402867 |
| Molecular Formula | C20H16ClF2N3O3S |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-[4-[6-chloro-5-[(2,5-difluorophenyl)sulfonylmethyl]-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2cnc(Cl)c(CS(=O)(=O)c3cc(F)ccc3F)c2C)ccn1 |
| InChI | InChI=1S/C20H16ClF2N3O3S/c1-11-15(13-5-6-24-19(7-13)26-12(2)27)9-25-20(21)16(11)10-30(28,29)18-8-14(22)3-4-17(18)23/h3-9H,10H2,1-2H3,(H,24,26,27) |
| InChIKey | QMSBLACVVMFTQP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|