C16H19ClN4O2S — CID 166785753
N-[4-[6-chloro-5-(3-hydroxypropylsulfanylamino)-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide (PubChem CID 166785753) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[4-[6-chloro-5-(3-hydroxypropylsulfanylamino)-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[6-chloro-5-(3-hydroxypropylsulfanylamino)-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166785753 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[4-[6-chloro-5-(3-hydroxypropylsulfanylamino)-4-methyl-3-pyridinyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2cnc(Cl)c(NSCCCO)c2C)ccn1 |
| InChI | InChI=1S/C16H19ClN4O2S/c1-10-13(12-4-5-18-14(8-12)20-11(2)23)9-19-16(17)15(10)21-24-7-3-6-22/h4-5,8-9,21-22H,3,6-7H2,1-2H3,(H,18,20,23) |
| InChIKey | JHPPXALWBYBJEA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|