C18H27N3O2S — CID 159404328
N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline (PubChem CID 159404328) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline.
| Compound Name | N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline |
|---|---|
| PubChem CID | 159404328 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline |
| SMILES | CNC.Cc1nccc2c(S(=O)(=O)N3CCCCC3C)cccc12 |
| InChI | InChI=1S/C16H20N2O2S.C2H7N/c1-12-6-3-4-11-18(12)21(19,20)16-8-5-7-14-13(2)17-10-9-15(14)16;1-3-2/h5,7-10,12H,3-4,6,11H2,1-2H3;3H,1-2H3 |
| InChIKey | LNTGYQAVUVOHOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |