About N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline
N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline (PubChem CID 159404328) has the molecular formula C18H27N3O2S
and a molecular weight of 349.50 g/mol. Its IUPAC name is N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline.
Molecular Properties
| Compound Name | N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline |
| PubChem CID | 159404328 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline |
| SMILES | CNC.Cc1nccc2c(S(=O)(=O)N3CCCCC3C)cccc12 |
| InChI | InChI=1S/C16H20N2O2S.C2H7N/c1-12-6-3-4-11-18(12)21(19,20)16-8-5-7-14-13(2)17-10-9-15(14)16;1-3-2/h5,7-10,12H,3-4,6,11H2,1-2H3;3H,1-2H3 |
| InChIKey | LNTGYQAVUVOHOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline?
The IUPAC name of N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline (CID 159404328) is N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline.
What is the SMILES notation for N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline?
The canonical SMILES for N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline is CNC.Cc1nccc2c(S(=O)(=O)N3CCCCC3C)cccc12.
What is the InChIKey of N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline?
The InChIKey is LNTGYQAVUVOHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S.C2H7N/c1-12-6-3-4-11-18(12)21(19,20)16-8-5-7-14-13(2)17-10-9-15(14)16;1-3-2/h5,7-10,12H,3-4,6,11H2,1-2H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline?
N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline has a molecular weight of 349.50 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;1-methyl-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline is sourced from PubChem (CID 159404328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).