C22H31ClN2O2S — CID 159397606
1-chloro-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline;methylcyclohexane (PubChem CID 159397606) has the molecular formula C22H31ClN2O2S and a molecular weight of 423.02 g/mol. Its IUPAC name is 1-chloro-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline;methylcyclohexane.
| Compound Name | 1-chloro-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline;methylcyclohexane |
|---|---|
| PubChem CID | 159397606 |
| Molecular Formula | C22H31ClN2O2S |
| Molecular Weight | 423.02 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-chloro-5-(2-methylpiperidin-1-yl)sulfonylisoquinoline;methylcyclohexane |
| SMILES | CC1CCCCC1.CC1CCCCN1S(=O)(=O)c1cccc2c(Cl)nccc12 |
| InChI | InChI=1S/C15H17ClN2O2S.C7H14/c1-11-5-2-3-10-18(11)21(19,20)14-7-4-6-13-12(14)8-9-17-15(13)16;1-7-5-3-2-4-6-7/h4,6-9,11H,2-3,5,10H2,1H3;7H,2-6H2,1H3 |
| InChIKey | LMXXJIMMACKWHA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.02 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|