C21H30ClN3O2S — CID 21278335
1-(1-chloroisoquinolin-5-yl)sulfonyl-N-hexyl-N-methylpiperidin-3-amine (PubChem CID 21278335) has the molecular formula C21H30ClN3O2S and a molecular weight of 424.01 g/mol. Its IUPAC name is 1-(1-chloroisoquinolin-5-yl)sulfonyl-N-hexyl-N-methylpiperidin-3-amine.
| Compound Name | 1-(1-chloroisoquinolin-5-yl)sulfonyl-N-hexyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 21278335 |
| Molecular Formula | C21H30ClN3O2S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-(1-chloroisoquinolin-5-yl)sulfonyl-N-hexyl-N-methylpiperidin-3-amine |
| SMILES | CCCCCCN(C)C1CCCN(S(=O)(=O)c2cccc3c(Cl)nccc23)C1 |
| InChI | InChI=1S/C21H30ClN3O2S/c1-3-4-5-6-14-24(2)17-9-8-15-25(16-17)28(26,27)20-11-7-10-19-18(20)12-13-23-21(19)22/h7,10-13,17H,3-6,8-9,14-16H2,1-2H3 |
| InChIKey | UPQKDZYYGFSJJE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|