C30H32F6N2O6 — CID 159407976
2-(1,2-dimethylindol-3-yl)-2-ethoxy-3,3,3-trifluoropropanoic acid;ethyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 159407976) has the molecular formula C30H32F6N2O6 and a molecular weight of 630.58 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-2-ethoxy-3,3,3-trifluoropropanoic acid;ethyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-2-ethoxy-3,3,3-trifluoropropanoic acid;ethyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 159407976 |
| Molecular Formula | C30H32F6N2O6 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-2-ethoxy-3,3,3-trifluoropropanoic acid;ethyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(c1c(C)n(C)c2ccccc12)C(F)(F)F.CCOC(C(=O)O)(c1c(C)n(C)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/2C15H16F3NO3/c1-4-22-13(20)14(21,15(16,17)18)12-9(2)19(3)11-8-6-5-7-10(11)12;1-4-22-14(13(20)21,15(16,17)18)12-9(2)19(3)11-8-6-5-7-10(11)12/h5-8,21H,4H2,1-3H3;5-8H,4H2,1-3H3,(H,20,21) |
| InChIKey | LOFAEZYPYHEOLH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |